Difference between revisions of "CPD-9459"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_1372 == * left end position: ** 3148 * transcription direction: ** POSITIVE * right end position: ** 9745 * centisome position: ** 13.10410...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] == * smiles: ** CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_1372 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] ==
−
* left end position:
+
* smiles:
−
** 3148
+
** CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** oleanolate
−
* right end position:
+
* inchi key:
−
** 9745
+
** InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M
−
* centisome position:
+
* molecular weight:
−
** 13.104108    
+
** 455.699    
 
* Synonym(s):
 
* Synonym(s):
 +
** oleanolic acid
 +
** oleanic acid
 +
** caryophyllin
 +
** 3-beta-Hydroxyolean-12-en-28-oic acid
 +
** oleonolic acid
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[VALINE--TRNA-LIGASE-RXN]]
+
* [[RXN-9000]]
−
** experimental_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[TRNA-CHARGING-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3148}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11865404 11865404]
−
{{#set: right end position=9745}}
+
* CHEMSPIDER:
−
{{#set: centisome position=13.104108   }}
+
** [http://www.chemspider.com/Chemical-Structure.10039737.html 10039737]
−
{{#set: reaction associated=VALINE--TRNA-LIGASE-RXN}}
+
* CHEBI:
−
{{#set: pathway associated=TRNA-CHARGING-PWY}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=82828 82828]
 +
* METABOLIGHTS : MTBLC37659
 +
* HMDB : HMDB02364
 +
{{#set: smiles=CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C}}
 +
{{#set: common name=oleanolate}}
 +
{{#set: inchi key=InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M}}
 +
{{#set: molecular weight=455.699   }}
 +
{{#set: common name=oleanolic acid|oleanic acid|caryophyllin|3-beta-Hydroxyolean-12-en-28-oic acid|oleonolic acid}}
 +
{{#set: consumed by=RXN-9000}}

Latest revision as of 20:14, 21 March 2018

Metabolite CPD-9459

  • smiles:
    • CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C
  • common name:
    • oleanolate
  • inchi key:
    • InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M
  • molecular weight:
    • 455.699
  • Synonym(s):
    • oleanolic acid
    • oleanic acid
    • caryophyllin
    • 3-beta-Hydroxyolean-12-en-28-oic acid
    • oleonolic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-9459&oldid=47084"