Difference between revisions of "CPD-9451"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ETHANOLAMINE-KINASE-RXN ETHANOLAMINE-KINASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == * smiles: ** CC(C(C(=O)[O-])=CC(=O)[O-])C * common name: ** 2-isopropylma...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C(C(=O)[O-])=CC(=O)[O-])C |
− | * | + | * common name: |
− | ** | + | ** 2-isopropylmaleate |
+ | * inchi key: | ||
+ | ** InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L | ||
+ | * molecular weight: | ||
+ | ** 156.138 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** β-isopropylmaleate | ||
+ | ** 2-isopropylmaleic acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[3-ISOPROPYLMALISOM-RXN]] | |
− | + | * [[RXN-8991]] | |
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21954611 21954611] |
− | * LIGAND- | + | * HMDB : HMDB12241 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02631 C02631] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10710392.html 10710392] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58085 58085] |
− | {{#set: | + | * BIGG : 2ippm |
+ | {{#set: smiles=CC(C(C(=O)[O-])=CC(=O)[O-])C}} | ||
+ | {{#set: common name=2-isopropylmaleate}} | ||
+ | {{#set: inchi key=InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L}} | ||
+ | {{#set: molecular weight=156.138 }} | ||
+ | {{#set: common name=β-isopropylmaleate|2-isopropylmaleic acid}} | ||
+ | {{#set: reversible reaction associated=3-ISOPROPYLMALISOM-RXN|RXN-8991}} |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-9451
- smiles:
- CC(C(C(=O)[O-])=CC(=O)[O-])C
- common name:
- 2-isopropylmaleate
- inchi key:
- InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L
- molecular weight:
- 156.138
- Synonym(s):
- β-isopropylmaleate
- 2-isopropylmaleic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12241
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 2ippm
"CC(C(C(=O)[O-])=CC(=O)[O-])C" cannot be used as a page name in this wiki.