Difference between revisions of "CPD-12932"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-D21-39-oxo-40-Me-C59-1-ACPs cis-D21-39-oxo-40-Me-C59-1-ACPs] == * common name: ** a cis-del...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12932 CPD-12932] == * smiles: ** CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12932 CPD-12932] == |
| + | * smiles: | ||
| + | ** CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C | ||
* common name: | * common name: | ||
| − | ** | + | ** all-trans-3,4-didehydrolycopene |
| + | * inchi key: | ||
| + | ** InChIKey=OCMSUPSDVXKDFY-FQMRBFJQSA-N | ||
| + | * molecular weight: | ||
| + | ** 534.867 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3,4-dehydrolycopene | ||
| + | ** 3,4-didehydrolycopene | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11999]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061227 16061227] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.17220904.html 17220904] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62474 62474] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15867 C15867] | ||
| + | {{#set: smiles=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C}} | ||
| + | {{#set: common name=all-trans-3,4-didehydrolycopene}} | ||
| + | {{#set: inchi key=InChIKey=OCMSUPSDVXKDFY-FQMRBFJQSA-N}} | ||
| + | {{#set: molecular weight=534.867 }} | ||
| + | {{#set: common name=3,4-dehydrolycopene|3,4-didehydrolycopene}} | ||
| + | {{#set: consumed by=RXN-11999}} | ||
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-12932
- smiles:
- CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C
- common name:
- all-trans-3,4-didehydrolycopene
- inchi key:
- InChIKey=OCMSUPSDVXKDFY-FQMRBFJQSA-N
- molecular weight:
- 534.867
- Synonym(s):
- 3,4-dehydrolycopene
- 3,4-didehydrolycopene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
