Difference between revisions of "CPD-11403"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNPGUANYLTRANGDP-RXN MANNPGUANYLTRANGDP-RXN] == * direction: ** REVERSIBLE * ec number: ** [http:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11403 CPD-11403] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2)) *...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11403 CPD-11403] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2)) |
− | * | + | * common name: |
− | ** | + | ** tetraiodothyroacetate |
+ | * inchi key: | ||
+ | ** InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M | ||
+ | * molecular weight: | ||
+ | ** 746.825 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Tetrac | ||
+ | ** tetraiodothyroacetic acid | ||
+ | ** TA4 | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10616]] | |
− | + | * [[RXN-10617]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237272 44237272] |
− | + | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))}} | |
− | + | {{#set: common name=tetraiodothyroacetate}} | |
− | + | {{#set: inchi key=InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M}} | |
− | + | {{#set: molecular weight=746.825 }} | |
− | + | {{#set: common name=Tetrac|tetraiodothyroacetic acid|TA4}} | |
− | {{#set: | + | {{#set: consumed by=RXN-10616|RXN-10617}} |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-11403
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))
- common name:
- tetraiodothyroacetate
- inchi key:
- InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M
- molecular weight:
- 746.825
- Synonym(s):
- Tetrac
- tetraiodothyroacetic acid
- TA4
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))" cannot be used as a page name in this wiki.