Difference between revisions of "RXN-9654"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] == * smiles: ** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9654 RXN-9654] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase ** 3-oxoa...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9654 RXN-9654] ==
−
* smiles:
+
* direction:
−
** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L
+
 
* common name:
 
* common name:
−
** GDP-β-L-gulose
+
** polyketide_synthase
−
* molecular weight:
+
** 3-oxoacyl-synthase
−
** 603.329   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[PROTON]][c] '''+''' 1 [[Myristoyl-ACPs]][c] '''+''' 1 [[MALONYL-COA]][c] '''=>''' 1 [[3-oxo-palmitoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c]
−
* [[RXN-7772]]
+
* With common name(s):
−
* [[RXN-7771]]
+
** 1 H+[c] '''+''' 1 a myristoyl-[acp][c] '''+''' 1 malonyl-CoA[c] '''=>''' 1 a 3-oxo-palmitoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15991]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_19302]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14485]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5939]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657274 90657274]
+
{{#set: common name=polyketide_synthase}}
−
* LIGAND-CPD:
+
{{#set: common name=3-oxoacyl-synthase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15925 C15925]
+
{{#set: ec number=EC-2.3.1.86}}
−
{{#set: smiles=C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O}}
+
{{#set: ec number=EC-2.3.1.85}}
−
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L}}
+
{{#set: ec number=EC-2.3.1.41}}
−
{{#set: common name=GDP-β-L-gulose}}
+
{{#set: gene associated=Tiso_gene_15991|Tiso_gene_136|Tiso_gene_19302|Tiso_gene_500|Tiso_gene_13394|Tiso_gene_14485|Tiso_gene_135|Tiso_gene_10876|Tiso_gene_5939}}
−
{{#set: molecular weight=603.329    }}
+
{{#set: in pathway=PWY-5994}}
−
{{#set: consumed or produced by=RXN-7772|RXN-7771}}
+
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:14, 21 March 2018

Reaction RXN-9654

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9654&oldid=47128"