Difference between revisions of "L-1-LYSOPHOSPHATIDATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Maltodextrins Maltodextrins] == * common name: ** a maltodextrin * Synonym(s): ** 4-{(1,4)-&alp...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == |
+ | * smiles: | ||
+ | ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O | ||
* common name: | * common name: | ||
− | ** | + | ** 1-oleyl-2-lyso-phosphatidate |
+ | * inchi key: | ||
+ | ** InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L | ||
+ | * molecular weight: | ||
+ | ** 434.509 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-2-lysophosphatidate |
− | ** | + | ** lysophosphatidic acid |
− | ** | + | ** LPA |
− | ** | + | ** oleoyl lysophosphatidic acid |
+ | ** 1-oleoyl-lyso-phosphatidic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-15043]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-15045]] | ||
+ | * [[RXN-15046]] | ||
+ | * [[RXN-15091]] | ||
+ | * [[RXN-15068]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173225 46173225] |
− | {{#set: consumed | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74544 74544] | ||
+ | * METABOLIGHTS : MTBLC74544 | ||
+ | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O}} | ||
+ | {{#set: common name=1-oleyl-2-lyso-phosphatidate}} | ||
+ | {{#set: inchi key=InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L}} | ||
+ | {{#set: molecular weight=434.509 }} | ||
+ | {{#set: common name=L-2-lysophosphatidate|lysophosphatidic acid|LPA|oleoyl lysophosphatidic acid|1-oleoyl-lyso-phosphatidic acid}} | ||
+ | {{#set: consumed by=RXN-15043}} | ||
+ | {{#set: produced by=RXN-15045|RXN-15046|RXN-15091|RXN-15068}} |
Latest revision as of 20:15, 21 March 2018
Contents
Metabolite L-1-LYSOPHOSPHATIDATE
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
- common name:
- 1-oleyl-2-lyso-phosphatidate
- inchi key:
- InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L
- molecular weight:
- 434.509
- Synonym(s):
- L-2-lysophosphatidate
- lysophosphatidic acid
- LPA
- oleoyl lysophosphatidic acid
- 1-oleoyl-lyso-phosphatidic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.