Difference between revisions of "CPD-330"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TDP TDP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2)) * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) * common name: ** L-galactono-1...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-galactono-1,4-lactone |
| + | * inchi key: | ||
| + | ** InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 178.141 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-galactono-γ-lactone |
| − | + | ** L-galactonate-γ-lactone | |
| − | ** | + | ** L-galactonic acid-γ-lactone |
| − | ** | + | ** L-galactonic acid-g-lactone |
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GALACTONOLACTONE-DEHYDROGENASE-RXN]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-1884]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-13183]] | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 1668-08-2 |
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857365 6857365] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.388522.html 388522] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17464 17464] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01115 C01115] |
| − | {{#set: | + | {{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}} |
| − | {{#set: | + | {{#set: common name=L-galactono-1,4-lactone}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N}} |
| − | {{#set: common name= | + | {{#set: molecular weight=178.141 }} |
| − | {{#set: consumed by= | + | {{#set: common name=L-galactono-γ-lactone|L-galactonate-γ-lactone|L-galactonic acid-γ-lactone|L-galactonic acid-g-lactone}} |
| − | {{#set: produced by= | + | {{#set: consumed by=GALACTONOLACTONE-DEHYDROGENASE-RXN}} |
| + | {{#set: produced by=RXN-1884}} | ||
| + | {{#set: reversible reaction associated=RXN-13183}} | ||
Latest revision as of 20:15, 21 March 2018
Contents
Metabolite CPD-330
- smiles:
- C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
- common name:
- L-galactono-1,4-lactone
- inchi key:
- InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N
- molecular weight:
- 178.141
- Synonym(s):
- L-galactono-γ-lactone
- L-galactonate-γ-lactone
- L-galactonic acid-γ-lactone
- L-galactonic acid-g-lactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)" cannot be used as a page name in this wiki.
