Difference between revisions of "CPD-12936"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_17758 == * left end position: ** 2065 * transcription direction: ** POSITIVE * right end position: ** 5071 * centisome position: ** 38.3686...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * smiles: ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_17758 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] ==
* left end position:
+
* smiles:
** 2065
+
** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
* transcription direction:
+
* common name:
** POSITIVE
+
** apo-4'-lycopenal
* right end position:
+
* inchi key:
** 5071
+
** InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
* centisome position:
+
* molecular weight:
** 38.368637    
+
** 482.748    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.2.1.18-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-11999]]
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=2065}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986183 50986183]
{{#set: right end position=5071}}
+
{{#set: smiles=CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O}}
{{#set: centisome position=38.368637   }}
+
{{#set: common name=apo-4'-lycopenal}}
{{#set: reaction associated=3.2.1.18-RXN}}
+
{{#set: inchi key=InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N}}
 +
{{#set: molecular weight=482.748   }}
 +
{{#set: produced by=RXN-11999}}

Latest revision as of 20:15, 21 March 2018

Metabolite CPD-12936

  • smiles:
    • CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
  • common name:
    • apo-4'-lycopenal
  • inchi key:
    • InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
  • molecular weight:
    • 482.748
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links