Difference between revisions of "MANNITOL-1P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8575 CPD-8575] == * common name: ** a 4-hydroxyacid * Synonym(s): ** a 4-hydroxyalkanoic ac...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * smiles: ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O * common name: *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8575 CPD-8575] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] ==
 +
* smiles:
 +
** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O
 
* common name:
 
* common name:
** a 4-hydroxyacid
+
** D-mannitol 1-phosphate
 +
* inchi key:
 +
** InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L
 +
* molecular weight:
 +
** 260.137   
 
* Synonym(s):
 
* Synonym(s):
** a 4-hydroxyalkanoic acid
+
** mannitol-1-P
** a 4-hydroxycarboxlic acid
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[MANNITOL-1-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[14-LACTONASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[MANNPDEHYDROG-RXN]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a 4-hydroxyacid}}
+
* CAS : 15806-48-1
{{#set: common name=a 4-hydroxyalkanoic acid|a 4-hydroxycarboxlic acid}}
+
* PUBCHEM:
{{#set: produced by=14-LACTONASE-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615341 23615341]
 +
* HMDB : HMDB01530
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00644 C00644]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.19951338.html 19951338]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61381 61381]
 +
* BIGG : mnl1p
 +
{{#set: smiles=C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O}}
 +
{{#set: common name=D-mannitol 1-phosphate}}
 +
{{#set: inchi key=InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L}}
 +
{{#set: molecular weight=260.137    }}
 +
{{#set: common name=mannitol-1-P}}
 +
{{#set: consumed by=MANNITOL-1-PHOSPHATASE-RXN}}
 +
{{#set: reversible reaction associated=MANNPDEHYDROG-RXN}}

Latest revision as of 20:15, 21 March 2018

Metabolite MANNITOL-1P

  • smiles:
    • C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O
  • common name:
    • D-mannitol 1-phosphate
  • inchi key:
    • InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L
  • molecular weight:
    • 260.137
  • Synonym(s):
    • mannitol-1-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O" cannot be used as a page name in this wiki.