Difference between revisions of "CPD-11402"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA80or ACOA80or] == * direction: ** LEFT-TO-RIGHT * common name: ** Octanoyl-CoA:oxygen 2-oxidore...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA80or ACOA80or] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))
 
* common name:
 
* common name:
−
** Octanoyl-CoA:oxygen 2-oxidoreductase
+
** 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide
 +
* inchi key:
 +
** InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M
 +
* molecular weight:
 +
** 826.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,5,3'-triiodothyronine acyl β-D-glucuronide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[FAD]][x] '''+''' 1.0 [[CPD-196]][x] '''=>''' 1.0 [[FADH2]][x] '''+''' 1.0 [[CPD0-2108]][x]
+
* [[RXN-10609]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 FAD[x] '''+''' 1.0 octanoyl-CoA[x] '''=>''' 1.0 FADH2[x] '''+''' 1.0 trans-oct-2-enoyl-CoA[x]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8272]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_18566]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_16674]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_17967]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Octanoyl-CoA:oxygen 2-oxidoreductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659330 90659330]
−
{{#set: gene associated=Tiso_gene_8272|Tiso_gene_18566|Tiso_gene_16674|Tiso_gene_17967}}
+
{{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))}}
−
{{#set: in pathway=}}
+
{{#set: common name=3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=826.095    }}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=3,5,3'-triiodothyronine acyl β-D-glucuronide}}
 +
{{#set: produced by=RXN-10609}}

Latest revision as of 20:15, 21 March 2018

Metabolite CPD-11402

  • smiles:
    • C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))
  • common name:
    • 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide
  • inchi key:
    • InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M
  • molecular weight:
    • 826.095
  • Synonym(s):
    • 3,5,3'-triiodothyronine acyl β-D-glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11402&oldid=47210"