Difference between revisions of "Tiso gene 14249"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13699 CPD-13699] == * smiles: ** CC(C(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_14249 == * right end position: ** 2054 * transcription direction: ** NEGATIVE * left end position: ** 21 * centisome position: ** 0.1932989...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13699 CPD-13699] ==
+
== Gene Tiso_gene_14249 ==
* smiles:
+
* right end position:
** CC(C(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))
+
** 2054
* inchi key:
+
* transcription direction:
** InChIKey=MUOUYOUSQGFFIP-GDRSPGQTSA-J
+
** NEGATIVE
* common name:
+
* left end position:
** 3,22-dioxochol-4-en-24-oyl-CoA
+
** 21
* molecular weight:
+
* centisome position:
** 1132.017    
+
** 0.19329897    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12710]]
+
* Reaction: [[DNA-LIGASE-ATP-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-17917]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17918]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17919]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=2054}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658756 90658756]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: left end position=21}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86014 86014]
+
{{#set: centisome position=0.19329897   }}
{{#set: smiles=CC(C(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))}}
+
{{#set: reaction associated=DNA-LIGASE-ATP-RXN|RXN-17917|RXN-17918|RXN-17919}}
{{#set: inchi key=InChIKey=MUOUYOUSQGFFIP-GDRSPGQTSA-J}}
+
{{#set: common name=3,22-dioxochol-4-en-24-oyl-CoA}}
+
{{#set: molecular weight=1132.017   }}
+
{{#set: consumed by=RXN-12710}}
+

Latest revision as of 21:15, 21 March 2018

Gene Tiso_gene_14249

  • right end position:
    • 2054
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 21
  • centisome position:
    • 0.19329897
  • Synonym(s):

Reactions associated

Pathways associated

External links