Difference between revisions of "CPD0-1108"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1108 CPD0-1108] == * smiles: ** C(C1(C(O)C(O)C(O)O1))O * inchi key: ** InChIKey=HMFHBZSHGG...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1108 CPD0-1108] == * smiles: ** C(C1(C(O)C(O)C(O)O1))O * common name: ** β-D-ribofura...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C1(C(O)C(O)C(O)O1))O | ** C(C1(C(O)C(O)C(O)O1))O | ||
| − | |||
| − | |||
* common name: | * common name: | ||
** β-D-ribofuranose | ** β-D-ribofuranose | ||
| + | * inchi key: | ||
| + | ** InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N | ||
* molecular weight: | * molecular weight: | ||
** 150.131 | ** 150.131 | ||
| Line 26: | Line 26: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=447347 447347] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=447347 447347] | ||
{{#set: smiles=C(C1(C(O)C(O)C(O)O1))O}} | {{#set: smiles=C(C1(C(O)C(O)C(O)O1))O}} | ||
| − | |||
{{#set: common name=β-D-ribofuranose}} | {{#set: common name=β-D-ribofuranose}} | ||
| + | {{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N}} | ||
{{#set: molecular weight=150.131 }} | {{#set: molecular weight=150.131 }} | ||
| − | {{#set: | + | {{#set: reversible reaction associated=RXN-14904|RXN0-5305}} |
Latest revision as of 19:04, 21 March 2018
Contents
Metabolite CPD0-1108
- smiles:
- C(C1(C(O)C(O)C(O)O1))O
- common name:
- β-D-ribofuranose
- inchi key:
- InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N
- molecular weight:
- 150.131
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
