Difference between revisions of "Tiso gene 4265"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...")
 
(Created page with "Category:Gene == Gene Tiso_gene_4265 == * Synonym(s): == Reactions associated == * Reaction: PROTEIN-KINASE-RXN ** Source: orthology-esiliculosus == Pathways asso...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
+
== Gene Tiso_gene_4265 ==
* smiles:
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
+
* common name:
+
** campest-4-en-3-one
+
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
** methylcholestenone
 
** (24R)-24-methyl-cholest-4-en-3-one
 
** 3-dehydro-Δ4-5-campesterol
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-711]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
* [[RXN-4231]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) known to produce the compound ==
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11988279 11988279]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785]
+
* HMDB : HMDB12196
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}}
+
{{#set: common name=campest-4-en-3-one}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}}
+
{{#set: consumed by=RXN-711|RXN-4231}}
+

Latest revision as of 20:15, 21 March 2018

Gene Tiso_gene_4265

  • Synonym(s):

Reactions associated

Pathways associated

External links