Difference between revisions of "R344-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] == * smiles: ** C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R344-RXN R344-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R344-RXN R344-RXN] ==
−
* smiles:
+
* direction:
−
** C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=ODBLHEXUDAPZAU-ZAFYKAAXSA-K
+
** [http://enzyme.expasy.org/EC/2.5.1.17 EC-2.5.1.17]
−
* common name:
+
−
** D-threo-isocitrate
+
−
* molecular weight:
+
−
** 189.101   
+
 
* Synonym(s):
 
* Synonym(s):
−
** D-threo-isocitrate
 
−
** (1R, 2S)-1-hydroxypropane-1,2,3-tricarboxylate
 
−
** D-threo-isocitric acid
 
−
** isocitric acid
 
−
** isocitrate
 
−
** threo-Ds-isocitrate
 
−
** I-CIT
 
−
** D-isocitrate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[CPD-694]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[P3I]][c] '''+''' 1 [[CPD-690]][c]
−
* [[ACONITATEHYDR-RXN]]
+
* With common name(s):
−
* [[ISOCITDEH-RXN]]
+
** 1 cob(I)yrinate a,c-diamide[c] '''+''' 1 ATP[c] '''=>''' 1 PPPi[c] '''+''' 1 adenosyl-cobyrinate a,c-diamide[c]
−
* [[RXN-14047]]
+
 
−
* [[ISOCIT-CLEAV-RXN]]
+
== Genes associated with this reaction  ==
−
* [[RXN-9951]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6190]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5509]], adenosylcobalamin biosynthesis from cobyrinate a,c-diamide I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5509 PWY-5509]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY-5508]], adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5508 PWY-5508]
 +
** '''3''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 320-77-4
+
* RHEA:
−
* CAS : 30810-51-6
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11528 11528]
−
* METABOLIGHTS : MTBLC15562
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R05220 R05220]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459771 5459771]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* KNAPSACK : C00001188
+
{{#set: ec number=EC-2.5.1.17}}
−
* HMDB : HMDB01874
+
{{#set: gene associated=Tiso_gene_6190}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-5509|PWY-5508}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00451 C00451]
+
{{#set: reconstruction category=orthology}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.chemspider.com/Chemical-Structure.4573553.html 4573553]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15562 15562]
+
−
* BIGG : icit
+
−
{{#set: smiles=C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=ODBLHEXUDAPZAU-ZAFYKAAXSA-K}}
+
−
{{#set: common name=D-threo-isocitrate}}
+
−
{{#set: molecular weight=189.101    }}
+
−
{{#set: common name=D-threo-isocitrate|(1R, 2S)-1-hydroxypropane-1,2,3-tricarboxylate|D-threo-isocitric acid|isocitric acid|isocitrate|threo-Ds-isocitrate|I-CIT|D-isocitrate}}
+
−
{{#set: consumed or produced by=ACONITATEHYDR-RXN|ISOCITDEH-RXN|RXN-14047|ISOCIT-CLEAV-RXN|RXN-9951}}
+

Latest revision as of 21:16, 21 March 2018

Reaction R344-RXN

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 cob(I)yrinate a,c-diamide[c] + 1 ATP[c] => 1 PPPi[c] + 1 adenosyl-cobyrinate a,c-diamide[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5509, adenosylcobalamin biosynthesis from cobyrinate a,c-diamide I: PWY-5509
    • 2 reactions found over 8 reactions in the full pathway
  • PWY-5508, adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II: PWY-5508
    • 3 reactions found over 9 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=R344-RXN&oldid=47321"