Difference between revisions of "RXN-11569"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMIDINE THYMIDINE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2)) * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11569 RXN-11569] == * direction: ** LEFT-TO-RIGHT * common name: ** iduronate-2-sulfatase * ec...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11569 RXN-11569] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** iduronate-2-sulfatase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.1.6.13 EC-3.1.6.13] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[Dermatan-sulfate-L-IdoA2S]][c] '''=>''' 1 [[SULFATE]][c] '''+''' 1 [[DERMATAN-L-IDURONATE]][c] '''+''' 2 [[PROTON]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 H2O[c] '''+''' 1 [dermatan-sulfate]-2-O-sulfo-α-L-iduronate[c] '''=>''' 1 sulfate[c] '''+''' 1 [dermatan]-α-L-iduronate[c] '''+''' 2 H+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_18595]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=iduronate-2-sulfatase}} | |
| − | + | {{#set: ec number=EC-3.1.6.13}} | |
| − | + | {{#set: gene associated=Tiso_gene_18595}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:16, 21 March 2018
Contents
Reaction RXN-11569
- direction:
- LEFT-TO-RIGHT
- common name:
- iduronate-2-sulfatase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Dermatan-sulfate-L-IdoA2S[c] => 1 SULFATE[c] + 1 DERMATAN-L-IDURONATE[c] + 2 PROTON[c]
- With common name(s):
- 1 H2O[c] + 1 [dermatan-sulfate]-2-O-sulfo-α-L-iduronate[c] => 1 sulfate[c] + 1 [dermatan]-α-L-iduronate[c] + 2 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18595
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
