Difference between revisions of "Tiso gene 1131"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_1131 == * right end position: ** 22185 * transcription direction: ** NEGATIVE * left end position: ** 21286 * centisome position: ** 82.347...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1131 == |
− | * | + | * right end position: |
− | ** | + | ** 22185 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 21286 |
− | * | + | * centisome position: |
− | ** | + | ** 82.34748 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[2.7.1.68-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-6352]] | ||
+ | * [[PWY-6351]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=22185}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=21286}} | |
− | {{#set: | + | {{#set: centisome position=82.34748 }} |
− | {{#set: | + | {{#set: reaction associated=2.7.1.68-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-6352|PWY-6351}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:16, 21 March 2018
Gene Tiso_gene_1131
- right end position:
- 22185
- transcription direction:
- NEGATIVE
- left end position:
- 21286
- centisome position:
- 82.34748
- Synonym(s):
Reactions associated
- Reaction: 2.7.1.68-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation