Difference between revisions of "CPD-13174"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R163-RXN R163-RXN] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ident...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * common name:...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O |
+ | * common name: | ||
+ | ** salicyl-6-hydroxy-2-cyclohexene-on-oyl | ||
+ | * inchi key: | ||
+ | ** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 262.262 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** salicyl-HCH | ||
+ | ** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester | ||
+ | ** acylsaligenin | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-12252]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 529507-98-0 |
− | ** [http:// | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723] |
− | {{#set: | + | {{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}} |
− | {{#set: | + | {{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}} |
− | {{#set: | + | {{#set: molecular weight=262.262 }} |
− | {{#set: | + | {{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}} |
+ | {{#set: consumed by=RXN-12252}} |
Latest revision as of 21:16, 21 March 2018
Contents
Metabolite CPD-13174
- smiles:
- C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
- common name:
- salicyl-6-hydroxy-2-cyclohexene-on-oyl
- inchi key:
- InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
- molecular weight:
- 262.262
- Synonym(s):
- salicyl-HCH
- 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
- acylsaligenin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 529507-98-0
- PUBCHEM: