Difference between revisions of "R311-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * smiles: ** C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R311-RXN R311-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Acrylamidase ** amidase * ec...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R311-RXN R311-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Acrylamidase |
| − | * | + | ** amidase |
| − | ** | + | * ec number: |
| + | ** [http://enzyme.expasy.org/EC/3.5.1.4 EC-3.5.1.4] | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[ACRYLAMIDE]][c] '''=>''' 1 [[ACRYLATE]][c] '''+''' 1 [[AMMONIUM]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 H2O[c] '''+''' 1 acrylamide[c] '''=>''' 1 acrylate[c] '''+''' 1 ammonium[c] |
| − | == | + | |
| − | == | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Tiso_gene_13682]] |
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-7308]], acrylonitrile degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7308 PWY-7308] | ||
| + | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34367 34367] | |
| − | + | * LIGAND-RXN: | |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05551 R05551] |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | * LIGAND- | + | {{#set: common name=Acrylamidase}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=amidase}} |
| − | + | {{#set: ec number=EC-3.5.1.4}} | |
| − | + | {{#set: gene associated=Tiso_gene_13682}} | |
| − | + | {{#set: in pathway=PWY-7308}} | |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:16, 21 March 2018
Contents
Reaction R311-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Acrylamidase
- amidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 ACRYLAMIDE[c] => 1 ACRYLATE[c] + 1 AMMONIUM[c]
- With common name(s):
- 1 H2O[c] + 1 acrylamide[c] => 1 acrylate[c] + 1 ammonium[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13682
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- PWY-7308, acrylonitrile degradation I: PWY-7308
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
