Difference between revisions of "Tiso gene 17123"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYINDOLE DIHYDROXYINDOLE] == * smiles: ** C1(=CNC2(=C1C=C(O)C(O)=C2)) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_17123 == * right end position: ** 2710 * transcription direction: ** NEGATIVE * left end position: ** 408 * centisome position: ** 5.753772...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17123 == |
− | * | + | * right end position: |
− | ** | + | ** 2710 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 408 |
− | * | + | * centisome position: |
− | ** | + | ** 5.7537723 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PGLYCDEHYDROG-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[PSERTRANSAM-RXN]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[PSERTRANSAMPYR-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[SERSYN-PWY]] | ||
+ | * [[PYRIDOXSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2710}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=408}} | |
− | + | {{#set: centisome position=5.7537723 }} | |
− | + | {{#set: reaction associated=PGLYCDEHYDROG-RXN|PSERTRANSAM-RXN|PSERTRANSAMPYR-RXN}} | |
− | + | {{#set: pathway associated=SERSYN-PWY|PYRIDOXSYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:16, 21 March 2018
Gene Tiso_gene_17123
- right end position:
- 2710
- transcription direction:
- NEGATIVE
- left end position:
- 408
- centisome position:
- 5.7537723
- Synonym(s):
Reactions associated
- Reaction: PGLYCDEHYDROG-RXN
- Source: orthology-esiliculosus
- Reaction: PSERTRANSAM-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: PSERTRANSAMPYR-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation