Difference between revisions of "RXN0-5182"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5182 RXN0-5182] == * direction: ** LEFT-TO-RIGHT * common name: ** thymidine_phosphorylase * e...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5182 RXN0-5182] ==
* smiles:
+
* direction:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O)[O-])O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=OTEACGAEDCIMBS-NOTSHUFBSA-I
+
 
* common name:
 
* common name:
** (3S)-hydroxyadipyl-CoA
+
** thymidine_phosphorylase
* molecular weight:
+
* ec number:
** 906.621   
+
** [http://enzyme.expasy.org/EC/2.4.1.1 EC-2.4.1.1]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[MALTOTETRAOSE]][c] '''+''' 1 [[Pi]][c] '''=>''' 1 [[MALTOTRIOSE]][c] '''+''' 1 [[GLC-1-P]][c]
* [[RXN-2425]]
+
* With common name(s):
* [[RXN0-2044]]
+
** 1 maltotetraose[c] '''+''' 1 phosphate[c] '''=>''' 1 maltotriose[c] '''+''' 1 α-D-glucopyranose 1-phosphate[c]
* [[RXN0-6513]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_1011]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[GLYCOCAT-PWY]], glycogen degradation I: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOCAT-PWY GLYCOCAT-PWY]
 +
** '''6''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70679061 70679061]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29691 29691]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=70990 70990]
+
{{#set: common name=thymidine_phosphorylase}}
* LIGAND-CPD:
+
{{#set: ec number=EC-2.4.1.1}}
** [http://www.genome.jp/dbget-bin/www_bget?C14145 C14145]
+
{{#set: gene associated=Tiso_gene_1011}}
* HMDB : HMDB12475
+
{{#set: in pathway=GLYCOCAT-PWY}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O)[O-])O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction category=annotation}}
{{#set: inchi key=InChIKey=OTEACGAEDCIMBS-NOTSHUFBSA-I}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: common name=(3S)-hydroxyadipyl-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: molecular weight=906.621    }}
+
{{#set: consumed or produced by=RXN-2425|RXN0-2044|RXN0-6513}}
+

Latest revision as of 20:16, 21 March 2018

Reaction RXN0-5182

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • thymidine_phosphorylase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 maltotetraose[c] + 1 phosphate[c] => 1 maltotriose[c] + 1 α-D-glucopyranose 1-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links