Difference between revisions of "Tiso gene 19156"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13008 CPD-13008] == * smiles: ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_19156 == * right end position: ** 2085 * transcription direction: ** POSITIVE * left end position: ** 214 * centisome position: ** 8.405342...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13008 CPD-13008] ==
+
== Gene Tiso_gene_19156 ==
−
* smiles:
+
* right end position:
−
** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O
+
** 2085
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3',5'-diiodothyronine
+
** 214
−
* molecular weight:
+
* centisome position:
−
** 525.081    
+
** 8.405342    
 
* Synonym(s):
 
* Synonym(s):
−
** 3',5'-diiodo-L-thyronine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12037]]
+
* Reaction: [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2085}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986088 50986088]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O}}
+
{{#set: left end position=214}}
−
{{#set: inchi key=InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N}}
+
{{#set: centisome position=8.405342   }}
−
{{#set: common name=3',5'-diiodothyronine}}
+
{{#set: reaction associated=PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN}}
−
{{#set: molecular weight=525.081   }}
+
−
{{#set: common name=3',5'-diiodo-L-thyronine}}
+
−
{{#set: consumed by=RXN-12037}}
+

Latest revision as of 20:16, 21 March 2018

Gene Tiso_gene_19156

  • right end position:
    • 2085
  • transcription direction:
    • POSITIVE
  • left end position:
    • 214
  • centisome position:
    • 8.405342
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19156&oldid=47381"