Difference between revisions of "Tiso gene 2667"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-]...")
 
(Created page with "Category:Gene == Gene Tiso_gene_2667 == * Synonym(s): == Reactions associated == * Reaction: 3PGAREARR-RXN ** Source: orthology-synechocystis == Pathways associat...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] ==
+
== Gene Tiso_gene_2667 ==
−
* smiles:
+
−
** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))
+
−
* inchi key:
+
−
** InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M
+
−
* common name:
+
−
** delphinidin
+
−
* molecular weight:
+
−
** 301.232   
+
 
* Synonym(s):
 
* Synonym(s):
−
** delfinidin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-9723]]
+
* Reaction: [[3PGAREARR-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-synechocystis]]
−
* [[RXN-7785]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-1042]]
 +
* [[P341-PWY]]
 +
* [[PWY-2221]]
 +
* [[GLUCONEO-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6901]]
 +
* [[PWY-7218]]
 +
* [[P124-PWY]]
 +
* [[PWY-6886]]
 +
* [[PWY-5723]]
 +
* [[PWY-6142]]
 +
* [[PWY-5484]]
 +
* [[PWY-7124]]
 +
* [[PWY-7003]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=3PGAREARR-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203213 25203213]
+
{{#set: pathway associated=PWY-1042|P341-PWY|PWY-2221|GLUCONEO-PWY|GLYCOLYSIS|PWY-6901|PWY-7218|P124-PWY|PWY-6886|PWY-5723|PWY-6142|PWY-5484|PWY-7124|PWY-7003}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28436 28436]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C05908 C05908]
+
−
* HMDB : HMDB03074
+
−
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))}}
+
−
{{#set: inchi key=InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M}}
+
−
{{#set: common name=delphinidin}}
+
−
{{#set: molecular weight=301.232    }}
+
−
{{#set: common name=delfinidin}}
+
−
{{#set: consumed by=RXN-9723}}
+
−
{{#set: produced by=RXN-7785}}
+

Latest revision as of 20:16, 21 March 2018

Gene Tiso_gene_2667

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2667&oldid=47384"