Difference between revisions of "RXN-14481"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] == * smiles: ** CC(OP([O-])([O-])=O)C([N+]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14481 RXN-14481] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14481 RXN-14481] ==
* smiles:
+
* direction:
** CC(OP([O-])([O-])=O)C([N+])C([O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=USRGIUJOYOXOQJ-GBXIJSLDSA-L
+
* common name:
+
** L-threonine 3-O-phosphate
+
* molecular weight:
+
** 197.084   
+
 
* Synonym(s):
 
* Synonym(s):
** O-phospho-L-threonine
 
** phosphothreonine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-8626]]
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[CPD-15360]][c] '''=>''' 1 [[CPD-11592]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 S-adenosyl-L-methionine[c] '''+''' 1 2-thio-N6-dimethylallyladenosine37 in tRNA[c] '''=>''' 1 2-methylthio-N6-dimethylallyladenosine37 in tRNA[c] '''+''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12431]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 1114-81-4
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_12431}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688171 36688171]
+
{{#set: in pathway=}}
* HMDB : HMDB11185
+
{{#set: reconstruction category=orthology}}
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
** [http://www.genome.jp/dbget-bin/www_bget?C12147 C12147]
+
{{#set: reconstruction tool=pantograph}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58675 58675]
+
* BIGG : thrp
+
{{#set: smiles=CC(OP([O-])([O-])=O)C([N+])C([O-])=O}}
+
{{#set: inchi key=InChIKey=USRGIUJOYOXOQJ-GBXIJSLDSA-L}}
+
{{#set: common name=L-threonine 3-O-phosphate}}
+
{{#set: molecular weight=197.084    }}
+
{{#set: common name=O-phospho-L-threonine|phosphothreonine}}
+
{{#set: produced by=RXN-8626}}
+

Latest revision as of 20:16, 21 March 2018

Reaction RXN-14481

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 S-adenosyl-L-methionine[c] + 1 2-thio-N6-dimethylallyladenosine37 in tRNA[c] => 1 2-methylthio-N6-dimethylallyladenosine37 in tRNA[c] + 1 H+[c] + 1 S-adenosyl-L-homocysteine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links