Difference between revisions of "Tiso gene 5087"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] == * smiles: ** CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_5087 == * Synonym(s): == Reactions associated == * Reaction: RIBITOL-2-DEHYDROGENASE-RXN ** Source: orthology-esiliculosus == Path...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] ==
+
== Gene Tiso_gene_5087 ==
* smiles:
+
** CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J
+
* common name:
+
** (2E,9Z)-hexadecenoyl-CoA
+
* molecular weight:
+
** 997.883   
+
 
* Synonym(s):
 
* Synonym(s):
** 16:2-Δ2,Δ9-CoA
 
** 2-trans,9-cis-hexadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RIBITOL-2-DEHYDROGENASE-RXN]]
* [[RXN-17788]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[RIBITOLUTIL-PWY]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=RIBITOL-2-DEHYDROGENASE-RXN}}
{{#set: inchi key=InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J}}
+
{{#set: pathway associated=RIBITOLUTIL-PWY}}
{{#set: common name=(2E,9Z)-hexadecenoyl-CoA}}
+
{{#set: molecular weight=997.883    }}
+
{{#set: common name=16:2-Δ2,Δ9-CoA|2-trans,9-cis-hexadecenoyl-CoA}}
+
{{#set: produced by=RXN-17788}}
+

Latest revision as of 20:16, 21 March 2018

Gene Tiso_gene_5087

  • Synonym(s):

Reactions associated

Pathways associated

External links