Difference between revisions of "CPD-19162"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9652 RXN-9652] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase ** polyket...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] == * smiles: ** CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9652 RXN-9652] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
−
** 3-oxoacyl-synthase
+
** (2E,9Z)-hexadecenoyl-CoA
−
** polyketide_synthase
+
* inchi key:
−
* ec number:
+
** InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J
−
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
+
** 997.883   
−
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 16:2-Δ2,Δ9-CoA
 +
** 2-trans,9-cis-hexadecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[Decanoyl-ACPs]][c] '''+''' 1 [[MALONYL-COA]][c] '''=>''' 1 [[3-oxo-dodecanoyl-ACPs]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
* [[RXN-17788]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 a decanoyl-[acp][c] '''+''' 1 malonyl-CoA[c] '''=>''' 1 a 3-oxo-dodecanoyl-[acp][c] '''+''' 1 coenzyme A[c] '''+''' 1 CO2[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13394]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_15991]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_10876]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_136]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_5939]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_14485]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_135]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_19302]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_500]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
−
** '''31''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: common name=3-oxoacyl-synthase}}
+
{{#set: common name=(2E,9Z)-hexadecenoyl-CoA}}
−
{{#set: common name=polyketide_synthase}}
+
{{#set: inchi key=InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J}}
−
{{#set: ec number=EC-2.3.1.86}}
+
{{#set: molecular weight=997.883    }}
−
{{#set: ec number=EC-2.3.1.85}}
+
{{#set: common name=16:2-Δ2,Δ9-CoA|2-trans,9-cis-hexadecenoyl-CoA}}
−
{{#set: ec number=EC-2.3.1.41}}
+
{{#set: produced by=RXN-17788}}
−
{{#set: gene associated=Tiso_gene_13394|Tiso_gene_15991|Tiso_gene_10876|Tiso_gene_136|Tiso_gene_5939|Tiso_gene_14485|Tiso_gene_135|Tiso_gene_19302|Tiso_gene_500}}
+
−
{{#set: in pathway=PWY-5994}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=esiliculosus}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Latest revision as of 20:16, 21 March 2018

Metabolite CPD-19162

  • smiles:
    • CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • (2E,9Z)-hexadecenoyl-CoA
  • inchi key:
    • InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J
  • molecular weight:
    • 997.883
  • Synonym(s):
    • 16:2-Δ2,Δ9-CoA
    • 2-trans,9-cis-hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-19162&oldid=47417"