Difference between revisions of "CPD-12852"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15881 RXN-15881] == * direction: ** LEFT-TO-RIGHT * common name: ** cysteine_desulfurase_for_ir...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15881 RXN-15881] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
 
* common name:
 
* common name:
** cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf
+
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
** cysteine_mitochondrial
+
* inchi key:
* ec number:
+
** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
+
* molecular weight:
 +
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-cholesta-8,24-dien-3β-ol
 +
** 4α,14α-dimethylzymosterol
 +
** 29-norlanosterol
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-11881]]
** 1 [[L-Cysteine-Desulfurases]][c] '''+''' 1 [[CYS]][c] '''=>''' 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[Persulfurated-L-cysteine-desulfurases]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 an [L-cysteine desulfurase][c] '''+''' 1 L-cysteine[c] '''=>''' 1 L-alanine[c] '''+''' 1 an S-sulfanyl-[L-cysteine desulfurase][c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_4284]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
** EXPERIMENTAL_ANNOTATION
+
***EC-NUMBER
+
** [[pantograph]]-[[esiliculosus]]
+
* [[Tiso_gene_11478]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
** EXPERIMENTAL_ANNOTATION
+
***EC-NUMBER
+
** [[pantograph]]-[[esiliculosus]]
+
* [[Tiso_gene_14710]]
+
** EXPERIMENTAL_ANNOTATION
+
***EC-NUMBER
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[PWY-7250]], [2Fe-2S] iron-sulfur cluster biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250]
+
** '''10''' reactions found over '''10''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[esiliculosus]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[experimental_annotation]]
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15101557 15101557]
{{#set: common name=cysteine_mitochondrial}}
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
{{#set: ec number=EC-2.8.1.7}}
+
{{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol}}
{{#set: gene associated=Tiso_gene_4284|Tiso_gene_11478|Tiso_gene_14710}}
+
{{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}}
{{#set: in pathway=PWY-7250}}
+
{{#set: molecular weight=412.698    }}
{{#set: reconstruction category=orthology}}
+
{{#set: common name=5α-cholesta-8,24-dien-3β-ol|4α,14α-dimethylzymosterol|29-norlanosterol}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-11881}}
{{#set: reconstruction source=esiliculosus}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Latest revision as of 20:17, 21 March 2018

Metabolite CPD-12852

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
  • common name:
    • 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
  • inchi key:
    • InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
  • molecular weight:
    • 412.698
  • Synonym(s):
    • 5α-cholesta-8,24-dien-3β-ol
    • 4α,14α-dimethylzymosterol
    • 29-norlanosterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.