Difference between revisions of "CPD-9007"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-]...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC5(C(O)C4(C(OP([O-])(=O)O4)O5)))([O-])=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ADP ribose 1'',2''-cyclic phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 618.26 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ADP ribose 1''-2''-cyclic phosphate |
− | ** 2, | + | ** ADP ribose 1'',2''-phosphate |
+ | ** adenosine diphosphate ribose 1'',2''-cyclic phosphate | ||
+ | ** Appr>p | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.7.1.160-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245989 25245989] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76596 76596] |
− | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC5(C(O)C4(C(OP([O-])(=O)O4)O5)))([O-])=O}} | |
− | + | {{#set: common name=ADP ribose 1'',2''-cyclic phosphate}} | |
− | + | {{#set: inchi key=InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K}} | |
− | {{#set: smiles=C( | + | {{#set: molecular weight=618.26 }} |
− | {{#set: | + | {{#set: common name=ADP ribose 1''-2''-cyclic phosphate|ADP ribose 1'',2''-phosphate|adenosine diphosphate ribose 1'',2''-cyclic phosphate|Appr>p}} |
− | {{#set: | + | {{#set: produced by=2.7.1.160-RXN}} |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite CPD-9007
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC5(C(O)C4(C(OP([O-])(=O)O4)O5)))([O-])=O
- common name:
- ADP ribose 1,2-cyclic phosphate
- inchi key:
- InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K
- molecular weight:
- 618.26
- Synonym(s):
- ADP ribose 1-2-cyclic phosphate
- ADP ribose 1,2-phosphate
- adenosine diphosphate ribose 1,2-cyclic phosphate
- Appr>p
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC5(C(O)C4(C(OP([O-])(=O)O4)O5)))([O-])=O" cannot be used as a page name in this wiki.
"Appr>p" cannot be used as a page name in this wiki.