Difference between revisions of "L-Cysteine-Desulfurase-persulfide"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10813 CPD-10813] == * smiles: ** C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Cysteine-Desulfurase-persulfide L-Cysteine-Desulfurase-persulfide] == * common name: ** an [L...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10813 CPD-10813] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Cysteine-Desulfurase-persulfide L-Cysteine-Desulfurase-persulfide] ==
−
* smiles:
+
−
** C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O
+
−
* inchi key:
+
−
** InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N
+
 
* common name:
 
* common name:
−
** 3,3',5'-triiodo-L-thyronine
+
** an [L-cysteine desulfurase] L-cysteine persulfide
−
* molecular weight:
+
−
** 650.978   
+
 
* Synonym(s):
 
* Synonym(s):
−
** reverse triiodothyronine
 
−
** rT3
 
−
** triiodothyronine, reverse
 
−
** 4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine
 
−
** O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-10604]]
+
* [[RXN-14382]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-308]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-12587]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an [L-cysteine desulfurase] L-cysteine persulfide}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123465 44123465]
+
{{#set: consumed by=RXN-14382}}
−
* CHEBI:
+
{{#set: produced by=RXN0-308}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57261 57261]
+
{{#set: reversible reaction associated=RXN-12587}}
−
* METABOLIGHTS : MTBLC57261
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C07639 C07639]
+
−
{{#set: smiles=C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O}}
+
−
{{#set: inchi key=InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N}}
+
−
{{#set: common name=3,3',5'-triiodo-L-thyronine}}
+
−
{{#set: molecular weight=650.978    }}
+
−
{{#set: common name=reverse triiodothyronine|rT3|triiodothyronine, reverse|4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine|O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine}}
+
−
{{#set: consumed by=RXN-10604}}
+

Latest revision as of 20:17, 21 March 2018

Metabolite L-Cysteine-Desulfurase-persulfide

  • common name:
    • an [L-cysteine desulfurase] L-cysteine persulfide
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [L-cysteine desulfurase] L-cysteine persulfide" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-Cysteine-Desulfurase-persulfide&oldid=47471"