Difference between revisions of "CPD-4124"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14986 RXN-14986] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-isopropylmalate dehydroge...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4124 CPD-4124] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[C...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14986 RXN-14986] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4124 CPD-4124] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** 3-isopropylmalate dehydrogenase
+
** 24-ethylidenelophenol
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.1.1.85 EC-1.1.1.85]
+
** InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N
 +
* molecular weight:
 +
** 426.724   
 
* Synonym(s):
 
* Synonym(s):
 +
** (Z)-24-ethylidenelophenol
 +
** citrostadienol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NAD]][c] '''+''' 1 [[CPD-1130]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[CPD-3618]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
* [[2.1.1.143-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NAD+[c] '''+''' 1 3-ethylmalate[c] '''=>''' 1 NADH[c] '''+''' 1 2-oxovalerate[c] '''+''' 1 CO2[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_2920]]
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7396]], butanol and isobutanol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7396 PWY-7396]
+
−
** '''4''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-isopropylmalate dehydrogenase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548595 9548595]
−
{{#set: ec number=EC-1.1.1.85}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_2920}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33203 33203]
−
{{#set: in pathway=PWY-7396}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11523 C11523]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: common name=24-ethylidenelophenol}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=426.724    }}
−
{{#set: reconstruction source=experimental_annotation}}
+
{{#set: common name=(Z)-24-ethylidenelophenol|citrostadienol}}
 +
{{#set: produced by=2.1.1.143-RXN}}

Latest revision as of 20:17, 21 March 2018

Metabolite CPD-4124

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 24-ethylidenelophenol
  • inchi key:
    • InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N
  • molecular weight:
    • 426.724
  • Synonym(s):
    • (Z)-24-ethylidenelophenol
    • citrostadienol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-4124&oldid=47480"