Difference between revisions of "ATCM"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == * smiles: ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InChI...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATCM ATCM] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:CMP phosphotransferase * Synonym(...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATCM ATCM] ==
−
* smiles:
+
* direction:
−
** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
−
** bupropion
+
** ATP:CMP phosphotransferase
−
* molecular weight:
+
−
** 240.752   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (-)-2-(tert-butylamino)-3'-chloropropiophenone
 
−
** 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
 
−
** (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
 
−
** amfebutamonum
 
−
** α-(tert-butylamino)-m-chloropropiophenone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-181]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CMP]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[CDP]][c] '''+''' 1.0 [[ADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 CMP[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 CDP[c] '''+''' 1.0 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_19734]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_9739]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB01156
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=ATP:CMP phosphotransferase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24849133 24849133]
+
{{#set: gene associated=Tiso_gene_19734|Tiso_gene_9739}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3219 3219]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06860 C06860]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB01510
+
−
{{#set: smiles=CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)}}
+
−
{{#set: inchi key=InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O}}
+
−
{{#set: common name=bupropion}}
+
−
{{#set: molecular weight=240.752    }}
+
−
{{#set: common name=(-)-2-(tert-butylamino)-3'-chloropropiophenone|1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-|(+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone|amfebutamonum|α-(tert-butylamino)-m-chloropropiophenone}}
+
−
{{#set: consumed by=RXN66-181}}
+

Latest revision as of 20:17, 21 March 2018

Reaction ATCM

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:CMP phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 CMP[c] + 1.0 ATP[c] => 1.0 CDP[c] + 1.0 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ATCM&oldid=47497"