Difference between revisions of "Tiso gene 13463"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == * smiles: ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_13463 == * right end position: ** 4689 * transcription direction: ** POSITIVE * left end position: ** 2389 * centisome position: ** 38.0777...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13463 == |
− | * | + | * right end position: |
− | ** | + | ** 4689 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2389 |
− | * | + | * centisome position: |
− | ** | + | ** 38.07778 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.7.1.148-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[NONMEVIPP-PWY]] | ||
+ | * [[PWY-7560]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4689}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: left end position=2389}} |
− | {{#set: | + | {{#set: centisome position=38.07778 }} |
− | {{#set: | + | {{#set: reaction associated=2.7.1.148-RXN}} |
− | {{#set: | + | {{#set: pathway associated=NONMEVIPP-PWY|PWY-7560}} |
− | {{#set: | + |
Latest revision as of 21:17, 21 March 2018
Gene Tiso_gene_13463
- right end position:
- 4689
- transcription direction:
- POSITIVE
- left end position:
- 2389
- centisome position:
- 38.07778
- Synonym(s):
Reactions associated
- Reaction: 2.7.1.148-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation