Difference between revisions of "RXN-15068"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] == * smiles: ** C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-] * inchi key: ** InChIKey=OUYCCCASQ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15068 RXN-15068] == * direction: ** LEFT-TO-RIGHT * common name: ** phospholipase A2 ** ORF **...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15068 RXN-15068] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phospholipase A2 |
− | * | + | ** ORF |
− | ** | + | ** abhydrolase_domain-containing_protein_4-like |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-8268]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[L-1-LYSOPHOSPHATIDATE]][c] '''+''' 1 [[OLEATE-CPD]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 dioleoyl phosphatidate[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 1-oleyl-2-lyso-phosphatidate[c] '''+''' 1 oleate[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | == | + | * Gene: [[Tiso_gene_15047]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: EC-NUMBER |
− | * [[ | + | * Gene: [[Tiso_gene_12960]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_15046]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_12959]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7417]], phospholipid remodeling (phosphatidate, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7417 PWY-7417] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=phospholipase A2}} | |
− | + | {{#set: common name=ORF}} | |
− | + | {{#set: common name=abhydrolase_domain-containing_protein_4-like}} | |
− | + | {{#set: ec number=EC-3.1.1.4}} | |
− | + | {{#set: gene associated=Tiso_gene_15047|Tiso_gene_12960|Tiso_gene_15046|Tiso_gene_12959}} | |
− | + | {{#set: in pathway=PWY-7417}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:17, 21 March 2018
Contents
Reaction RXN-15068
- direction:
- LEFT-TO-RIGHT
- common name:
- phospholipase A2
- ORF
- abhydrolase_domain-containing_protein_4-like
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-8268[c] + 1 WATER[c] => 1 PROTON[c] + 1 L-1-LYSOPHOSPHATIDATE[c] + 1 OLEATE-CPD[c]
- With common name(s):
- 1 dioleoyl phosphatidate[c] + 1 H2O[c] => 1 H+[c] + 1 1-oleyl-2-lyso-phosphatidate[c] + 1 oleate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_15047
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_12960
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_15046
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_12959
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7417, phospholipid remodeling (phosphatidate, yeast): PWY-7417
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation