Difference between revisions of "RXN-15068"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] == * smiles: ** C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-] * inchi key: ** InChIKey=OUYCCCASQ...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15068 RXN-15068] == * direction: ** LEFT-TO-RIGHT * common name: ** phospholipase A2 ** ORF **...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15068 RXN-15068] ==
−
* smiles:
+
* direction:
−
** C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OUYCCCASQSFEME-QMMMGPOBSA-N
+
 
* common name:
 
* common name:
−
** L-tyrosine
+
** phospholipase A2
−
* molecular weight:
+
** ORF
−
** 181.191   
+
** abhydrolase_domain-containing_protein_4-like
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4]
 
* Synonym(s):
 
* Synonym(s):
−
** Y
 
−
** tyr
 
−
** tyrosine
 
−
** L-tyr
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
+
* With identifiers:
−
* [[6.3.2.25-RXN]]
+
** 1 [[CPD-8268]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[L-1-LYSOPHOSPHATIDATE]][c] '''+''' 1 [[OLEATE-CPD]][c]
−
* [[RME144]]
+
* With common name(s):
−
* [[TYROSINE-DECARBOXYLASE-RXN]]
+
** 1 dioleoyl phosphatidate[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 1-oleyl-2-lyso-phosphatidate[c] '''+''' 1 oleate[c]
−
* [[TYROSINE--TRNA-LIGASE-RXN]]
+
 
−
* [[RXN-5861]]
+
== Genes associated with this reaction  ==
−
* [[TRANS-RXN-77]]
+
Genes have been associated with this reaction based on different elements listed below.
−
== Reaction(s) known to produce the compound ==
+
* Gene: [[Tiso_gene_15047]]
−
* [[TRANS-RXN-77]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: EC-NUMBER
−
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
+
* Gene: [[Tiso_gene_12960]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_15046]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_12959]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7417]], phospholipid remodeling (phosphatidate, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7417 PWY-7417]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 60-18-4
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC58315
+
{{#set: common name=phospholipase A2}}
−
* PUBCHEM:
+
{{#set: common name=ORF}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6942100 6942100]
+
{{#set: common name=abhydrolase_domain-containing_protein_4-like}}
−
* HMDB : HMDB00158
+
{{#set: ec number=EC-3.1.1.4}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_15047|Tiso_gene_12960|Tiso_gene_15046|Tiso_gene_12959}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00082 C00082]
+
{{#set: in pathway=PWY-7417}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58315 58315]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
* BIGG : tyr__L
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=OUYCCCASQSFEME-QMMMGPOBSA-N}}
+
−
{{#set: common name=L-tyrosine}}
+
−
{{#set: molecular weight=181.191    }}
+
−
{{#set: common name=Y|tyr|tyrosine|L-tyr}}
+
−
{{#set: consumed by=MONOPHENOL-MONOOXYGENASE-RXN|6.3.2.25-RXN|RME144|TYROSINE-DECARBOXYLASE-RXN|TYROSINE--TRNA-LIGASE-RXN|RXN-5861|TRANS-RXN-77}}
+
−
{{#set: produced by=TRANS-RXN-77}}
+
−
{{#set: consumed or produced by=TYROSINE-AMINOTRANSFERASE-RXN}}
+

Latest revision as of 20:17, 21 March 2018

Reaction RXN-15068

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • phospholipase A2
    • ORF
    • abhydrolase_domain-containing_protein_4-like
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7417, phospholipid remodeling (phosphatidate, yeast): PWY-7417
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15068&oldid=47507"