Difference between revisions of "CPD-11673"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_1840 == * left end position: ** 9589 * transcription direction: ** NEGATIVE * right end position: ** 12232 * centisome position: ** 44.5337...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == * smiles: ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_1840 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] ==
* left end position:
+
* smiles:
** 9589
+
** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))
* transcription direction:
+
* common name:
** NEGATIVE
+
** 5-hydroxytryptophol glucuronide
* right end position:
+
* inchi key:
** 12232
+
** InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N
* centisome position:
+
* molecular weight:
** 44.53372    
+
** 353.328    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.1.3.16-RXN]]
+
== Reaction(s) known to produce the compound ==
** experimental_annotation
+
* [[RXN-10784]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=9589}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173086 46173086]
{{#set: right end position=12232}}
+
{{#set: smiles=C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))}}
{{#set: centisome position=44.53372   }}
+
{{#set: common name=5-hydroxytryptophol glucuronide}}
{{#set: reaction associated=3.1.3.16-RXN}}
+
{{#set: inchi key=InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=353.328   }}
 +
{{#set: produced by=RXN-10784}}

Latest revision as of 20:17, 21 March 2018

Metabolite CPD-11673

  • smiles:
    • C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))
  • common name:
    • 5-hydroxytryptophol glucuronide
  • inchi key:
    • InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N
  • molecular weight:
    • 353.328
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links