Difference between revisions of "RXN-15511"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] == * smiles: ** C(C([N+])C(=O)[O-])S([O-])=O * inchi key: **...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15511 RXN-15511] == * direction: ** REVERSIBLE * common name: ** phosphoglycerate_mutase ** bis...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15511 RXN-15511] ==
−
* smiles:
+
* direction:
−
** C(C([N+])C(=O)[O-])S([O-])=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=ADVPTQAUNPRNPO-REOHCLBHSA-M
+
 
* common name:
 
* common name:
−
** 3-sulfinoalanine
+
** phosphoglycerate_mutase
−
* molecular weight:
+
** bisphosphoglycerate-dependent_phosphoglycerate_mutase
−
** 152.145   
+
** ORF
 +
** plastid_phosphoglycerate_mutase_protein
 
* Synonym(s):
 
* Synonym(s):
−
** cysteine sulfinate
 
−
** cysteine sulphinate
 
−
** L-cysteine sulfinate
 
−
** 3-sulfino-L-alanine
 
−
** L-cysteinesulfinic acid
 
−
** 3-sulphino-L-alanine
 
−
** cysteine-sulfinate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[CYSTEINE-DIOXYGENASE-RXN]]
+
** 1 [[23-DIPHOSPHOGLYCERATE]][c] '''+''' 1 [[Protein-Histidines]][c] '''<=>''' 1 [[G3P]][c] '''+''' 1 [[Protein-pi-phospho-L-histidines]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
+
** 1 2,3-diphospho-D-glycerate[c] '''+''' 1 a [protein]-L-histidine[c] '''<=>''' 1 3-phospho-D-glycerate[c] '''+''' 1 a [protein]-N&pi;-phospho-L-histidine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2365]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_2841]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_9923]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7201]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_9922]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_16271]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14530]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14664]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6405]], Rapoport-Luebering glycolytic shunt: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6405 PWY-6405]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1115-65-7
+
{{#set: direction=REVERSIBLE}}
−
* METABOLIGHTS : MTBLC61085
+
{{#set: common name=phosphoglycerate_mutase}}
−
* PUBCHEM:
+
{{#set: common name=bisphosphoglycerate-dependent_phosphoglycerate_mutase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549097 1549097]
+
{{#set: common name=ORF}}
−
* HMDB : HMDB60179
+
{{#set: common name=plastid_phosphoglycerate_mutase_protein}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_2365|Tiso_gene_2841|Tiso_gene_9923|Tiso_gene_7201|Tiso_gene_9922|Tiso_gene_16271|Tiso_gene_14530|Tiso_gene_14664}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00606 C00606]
+
{{#set: in pathway=PWY-6405}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.1266064.html 1266064]
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61085 61085]
+
−
* BIGG : 3sala
+
−
{{#set: smiles=C(C([N+])C(=O)[O-])S([O-])=O}}
+
−
{{#set: inchi key=InChIKey=ADVPTQAUNPRNPO-REOHCLBHSA-M}}
+
−
{{#set: common name=3-sulfinoalanine}}
+
−
{{#set: molecular weight=152.145    }}
+
−
{{#set: common name=cysteine sulfinate|cysteine sulphinate|L-cysteine sulfinate|3-sulfino-L-alanine|L-cysteinesulfinic acid|3-sulphino-L-alanine|cysteine-sulfinate}}
+
−
{{#set: produced by=CYSTEINE-DIOXYGENASE-RXN}}
+
−
{{#set: consumed or produced by=3-SULFINOALANINE-AMINOTRANSFERASE-RXN}}
+

Latest revision as of 20:18, 21 March 2018

Reaction RXN-15511

  • direction:
    • REVERSIBLE
  • common name:
    • phosphoglycerate_mutase
    • bisphosphoglycerate-dependent_phosphoglycerate_mutase
    • ORF
    • plastid_phosphoglycerate_mutase_protein
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6405, Rapoport-Luebering glycolytic shunt: PWY-6405
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15511&oldid=47572"