Difference between revisions of "RXN-15511"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] == * smiles: ** C(C([N+])C(=O)[O-])S([O-])=O * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15511 RXN-15511] == * direction: ** REVERSIBLE * common name: ** phosphoglycerate_mutase ** bis...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15511 RXN-15511] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phosphoglycerate_mutase |
− | * | + | ** bisphosphoglycerate-dependent_phosphoglycerate_mutase |
− | ** | + | ** ORF |
+ | ** plastid_phosphoglycerate_mutase_protein | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[23-DIPHOSPHOGLYCERATE]][c] '''+''' 1 [[Protein-Histidines]][c] '''<=>''' 1 [[G3P]][c] '''+''' 1 [[Protein-pi-phospho-L-histidines]][c] |
− | == | + | * With common name(s): |
− | * [[3- | + | ** 1 2,3-diphospho-D-glycerate[c] '''+''' 1 a [protein]-L-histidine[c] '''<=>''' 1 3-phospho-D-glycerate[c] '''+''' 1 a [protein]-Nπ-phospho-L-histidine[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_2365]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_2841]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_9923]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_7201]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_9922]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_16271]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14530]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14664]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-6405]], Rapoport-Luebering glycolytic shunt: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6405 PWY-6405] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=phosphoglycerate_mutase}} | |
− | + | {{#set: common name=bisphosphoglycerate-dependent_phosphoglycerate_mutase}} | |
− | + | {{#set: common name=ORF}} | |
− | + | {{#set: common name=plastid_phosphoglycerate_mutase_protein}} | |
− | + | {{#set: gene associated=Tiso_gene_2365|Tiso_gene_2841|Tiso_gene_9923|Tiso_gene_7201|Tiso_gene_9922|Tiso_gene_16271|Tiso_gene_14530|Tiso_gene_14664}} | |
− | + | {{#set: in pathway=PWY-6405}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:18, 21 March 2018
Contents
Reaction RXN-15511
- direction:
- REVERSIBLE
- common name:
- phosphoglycerate_mutase
- bisphosphoglycerate-dependent_phosphoglycerate_mutase
- ORF
- plastid_phosphoglycerate_mutase_protein
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 23-DIPHOSPHOGLYCERATE[c] + 1 Protein-Histidines[c] <=> 1 G3P[c] + 1 Protein-pi-phospho-L-histidines[c]
- With common name(s):
- 1 2,3-diphospho-D-glycerate[c] + 1 a [protein]-L-histidine[c] <=> 1 3-phospho-D-glycerate[c] + 1 a [protein]-Nπ-phospho-L-histidine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2365
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_2841
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_9923
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_7201
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_9922
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_16271
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14530
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14664
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-6405, Rapoport-Luebering glycolytic shunt: PWY-6405
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation