Difference between revisions of "Tiso gene 5716"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_5716 == * right end position: ** 3268 * transcription direction: ** NEGATIVE * left end position: ** 627 * centisome position: ** 4.8119726...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] ==
+
== Gene Tiso_gene_5716 ==
−
* smiles:
+
* right end position:
−
** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
+
** 3268
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** dCTP
+
** 627
−
* molecular weight:
+
* centisome position:
−
** 463.127    
+
** 4.8119726    
 
* Synonym(s):
 
* Synonym(s):
−
** 2'-deoxycytidine-5'-triphosphate
 
−
** deoxycytidine-triphosphate
 
−
** deoxy-CTP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14198]]
+
* Reaction: [[RXN-12086]]
−
* [[DCTP-PYROPHOSPHATASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[DCTCP]]
+
*** Assignment: ec-number
−
* [[RME255]]
+
** Source: [[orthology-esiliculosus]]
−
* [[DCTUP]]
+
* Reaction: [[RXN-12579]]
−
* [[RXN-14216]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
−
* [[ATDCD]]
+
** Source: [[orthology-esiliculosus]]
−
* [[DCDPKIN-RXN]]
+
* Reaction: [[TRIACYLGLYCEROL-LIPASE-RXN]]
−
* [[ATDCDm]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[LIPAS-PWY]]
 +
* [[PWY-6857]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2056-98-6
+
{{#set: right end position=3268}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665]
+
{{#set: left end position=627}}
−
* HMDB : HMDB00998
+
{{#set: centisome position=4.8119726   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-12086|RXN-12579|TRIACYLGLYCEROL-LIPASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458]
+
{{#set: pathway associated=LIPAS-PWY|PWY-6857}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481]
+
−
* BIGG : dctp
+
−
{{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
+
−
{{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}}
+
−
{{#set: common name=dCTP}}
+
−
{{#set: molecular weight=463.127   }}
+
−
{{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}}
+
−
{{#set: consumed by=RXN-14198|DCTP-PYROPHOSPHATASE-RXN|DCTCP|RME255|DCTUP|RXN-14216}}
+
−
{{#set: produced by=ATDCD|DCDPKIN-RXN|ATDCDm}}
+

Latest revision as of 20:18, 21 March 2018

Gene Tiso_gene_5716

  • right end position:
    • 3268
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 627
  • centisome position:
    • 4.8119726
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5716&oldid=47585"