Difference between revisions of "DCTP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARALDEHYDE COUMARALDEHYDE] == * smiles: ** C(=O)C=CC1(C=CC(O)=CC=1) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** dCTP |
| + | * inchi key: | ||
| + | ** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 463.127 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2'-deoxycytidine-5'-triphosphate |
| − | ** | + | ** deoxycytidine-triphosphate |
| + | ** deoxy-CTP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14198]] |
| + | * [[DCTP-PYROPHOSPHATASE-RXN]] | ||
| + | * [[DCTCP]] | ||
| + | * [[RME255]] | ||
| + | * [[DCTUP]] | ||
| + | * [[RXN-14216]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ATDCD]] |
| + | * [[DCDPKIN-RXN]] | ||
| + | * [[ATDCDm]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 2056-98-6 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665] |
| − | * HMDB : | + | * HMDB : HMDB00998 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481] |
| − | * | + | * BIGG : dctp |
| − | {{#set: smiles=C( | + | {{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} |
| − | {{#set: | + | {{#set: common name=dCTP}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=463.127 }} |
| − | {{#set: common name= | + | {{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}} |
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-14198|DCTP-PYROPHOSPHATASE-RXN|DCTCP|RME255|DCTUP|RXN-14216}} |
| − | {{#set: produced by= | + | {{#set: produced by=ATDCD|DCDPKIN-RXN|ATDCDm}} |
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite DCTP
- smiles:
- C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- common name:
- dCTP
- inchi key:
- InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
- molecular weight:
- 463.127
- Synonym(s):
- 2'-deoxycytidine-5'-triphosphate
- deoxycytidine-triphosphate
- deoxy-CTP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
