Difference between revisions of "Tiso gene 18096"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] == * smiles: ** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18096 == * right end position: ** 2799 * transcription direction: ** NEGATIVE * left end position: ** 46 * centisome position: ** 1.4132105...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] ==
+
== Gene Tiso_gene_18096 ==
* smiles:
+
* right end position:
** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))
+
** 2799
* inchi key:
+
* transcription direction:
** InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N
+
** NEGATIVE
* common name:
+
* left end position:
** 26,27-dehydrozymosterol
+
** 46
* molecular weight:
+
* centisome position:
** 382.628    
+
** 1.4132105    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-11201]]
+
* Reaction: [[3.5.1.98-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=2799}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820155 91820155]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))}}
+
{{#set: left end position=46}}
{{#set: inchi key=InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N}}
+
{{#set: centisome position=1.4132105   }}
{{#set: common name=26,27-dehydrozymosterol}}
+
{{#set: reaction associated=3.5.1.98-RXN}}
{{#set: molecular weight=382.628   }}
+
{{#set: consumed by=RXN-11201}}
+

Latest revision as of 19:12, 21 March 2018

Gene Tiso_gene_18096

  • right end position:
    • 2799
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 46
  • centisome position:
    • 1.4132105
  • Synonym(s):

Reactions associated

Pathways associated

External links