Difference between revisions of "RXN-14225"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14225 RXN-14225] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.2...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14225 RXN-14225] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 2 [[WATER]][c] '''+''' 1 [[D-GLUCURONOLACTONE]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[D-GLUCARATE]][c] '''+''' 3 [[PROTON]][c] '''+''' 1 [[NADH]][c] |
− | == | + | * With common name(s): |
+ | ** 2 H2O[c] '''+''' 1 D-glucurono-6,3-lactone[c] '''+''' 1 NAD+[c] '''<=>''' 1 D-glucarate[c] '''+''' 3 H+[c] '''+''' 1 NADH[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_3513]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_7322]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30886 30886] | |
− | + | * LIGAND-RXN: | |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02957 R02957] |
− | * LIGAND- | + | {{#set: direction=REVERSIBLE}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-1.2.1.3}} |
− | + | {{#set: gene associated=Tiso_gene_3513|Tiso_gene_7322}} | |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:18, 21 March 2018
Contents
Reaction RXN-14225
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 WATER[c] + 1 D-GLUCURONOLACTONE[c] + 1 NAD[c] <=> 1 D-GLUCARATE[c] + 3 PROTON[c] + 1 NADH[c]
- With common name(s):
- 2 H2O[c] + 1 D-glucurono-6,3-lactone[c] + 1 NAD+[c] <=> 1 D-glucarate[c] + 3 H+[c] + 1 NADH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3513
- Source: orthology-athaliana
- Gene: Tiso_gene_7322
- Source: orthology-athaliana
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
External links