Difference between revisions of "Tiso gene 20206"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALCOHOL CONIFERYL-ALCOHOL] == * smiles: ** COC1(=CC(C=CCO)=CC=C(O)1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_20206 == * Synonym(s): == Reactions associated == * Reaction: PEROXID-RXN ** Source: orthology-esiliculosus * Reaction: RXN-1424...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_20206 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PEROXID-RXN]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | == | + | * Reaction: [[RXN-14240]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-15288]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-8635]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7445]] | ||
+ | * [[PWY-7214]] | ||
+ | * [[PWY-5461]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=PEROXID-RXN|RXN-14240|RXN-15288|RXN-8635}} | |
− | + | {{#set: pathway associated=PWY-7445|PWY-7214|PWY-5461}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 20:18, 21 March 2018
Gene Tiso_gene_20206
- Synonym(s):
Reactions associated
- Reaction: PEROXID-RXN
- Source: orthology-esiliculosus
- Reaction: RXN-14240
- Source: orthology-esiliculosus
- Reaction: RXN-15288
- Source: orthology-esiliculosus
- Reaction: RXN-8635
- Source: orthology-esiliculosus