Difference between revisions of "RXN-698"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-698 RXN-698] == * direction: ** LEFT-TO-RIGHT * common name: ** 9-cis-epoxycarotenoid_dioxygena...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-698 RXN-698] ==
−
* smiles:
+
* direction:
−
** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L
+
 
* common name:
 
* common name:
−
** GDP-β-L-galactose
+
** 9-cis-epoxycarotenoid_dioxygenase
−
* molecular weight:
+
** 9-cis-epoxycarotenoid_neoxanthin_cleavage_enzyme-like_protein
−
** 603.329   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.13.11.51 EC-1.13.11.51]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[CPD-7424]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD1F-4]][c] '''+''' 1 [[CPD-7279]][c]
−
* [[RXN-7772]]
+
* With common name(s):
−
* [[RXN-1882]]
+
** 1 9'-cis-neoxanthin[c] '''+''' 1 oxygen[c] '''=>''' 1 (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al[c] '''+''' 1 2-cis,4-trans-xanthoxin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4653]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7740]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-695]], abscisic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-695 PWY-695]
 +
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200538 25200538]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19677 19677]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61454 61454]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06952 R06952]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02280 C02280]
+
{{#set: common name=9-cis-epoxycarotenoid_dioxygenase}}
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O}}
+
{{#set: common name=9-cis-epoxycarotenoid_neoxanthin_cleavage_enzyme-like_protein}}
−
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L}}
+
{{#set: ec number=EC-1.13.11.51}}
−
{{#set: common name=GDP-β-L-galactose}}
+
{{#set: gene associated=Tiso_gene_4653|Tiso_gene_7740}}
−
{{#set: molecular weight=603.329    }}
+
{{#set: in pathway=PWY-695}}
−
{{#set: consumed or produced by=RXN-7772|RXN-1882}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 21:18, 21 March 2018

Reaction RXN-698

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 9-cis-epoxycarotenoid_dioxygenase
    • 9-cis-epoxycarotenoid_neoxanthin_cleavage_enzyme-like_protein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 9'-cis-neoxanthin[c] + 1 oxygen[c] => 1 (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al[c] + 1 2-cis,4-trans-xanthoxin[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-695, abscisic acid biosynthesis: PWY-695
    • 1 reactions found over 5 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-698&oldid=47622"