|
|
(3 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA-ACP-TRANSACYL-RXN MALONYL-COA-ACP-TRANSACYL-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O |
| * common name: | | * common name: |
− | ** polyketide_synthase | + | ** GDP-β-L-galactose |
− | ** malonyl-_:acp_transacylase
| + | * inchi key: |
− | * ec number: | + | ** InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L |
− | ** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86] | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85] | + | ** 603.329 |
− | ** [http://enzyme.expasy.org/EC/2.3.1.39 EC-2.3.1.39] | + | |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[ACP]][c] '''+''' 1 [[MALONYL-COA]][c] '''=>''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[CO-A]][c]
| + | == Reaction(s) of unknown directionality == |
− | * With common name(s):
| + | * [[RXN-7772]] |
− | ** 1 a holo-[acyl-carrier protein][c] '''+''' 1 malonyl-CoA[c] '''=>''' 1 a malonyl-[acp][c] '''+''' 1 coenzyme A[c]
| + | * [[RXN-1882]] |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_135]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_500]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_10876]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_13394]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_19309]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_136]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_18460]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-6799]], fatty acid biosynthesis (plant mitochondria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6799 PWY-6799]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-7388]], octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7388 PWY-7388]
| + | |
− | ** '''9''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-4381]], fatty acid biosynthesis initiation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381]
| + | |
− | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]: | + | |
− | ** [[pantograph]]:
| + | |
− | *** [[synechocystis]]
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[manual]]:
| + | |
− | ** [[primary_network]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * LIGAND-RXN: | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01626 R01626] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200538 25200538] |
− | * UNIPROT:
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P72391 P72391]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61454 61454] |
− | ** [http://www.uniprot.org/uniprot/P49327 P49327]
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/O34825 O34825] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02280 C02280] |
− | ** [http://www.uniprot.org/uniprot/Q9RT24 Q9RT24] | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O}} |
− | ** [http://www.uniprot.org/uniprot/Q9JW58 Q9JW58]
| + | {{#set: common name=GDP-β-L-galactose}} |
− | ** [http://www.uniprot.org/uniprot/P0AAI9 P0AAI9]
| + | {{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L}} |
− | ** [http://www.uniprot.org/uniprot/O24916 O24916] | + | {{#set: molecular weight=603.329 }} |
− | ** [http://www.uniprot.org/uniprot/Q9JXR4 Q9JXR4] | + | {{#set: reversible reaction associated=RXN-7772|RXN-1882}} |
− | ** [http://www.uniprot.org/uniprot/Q9ZCJ6 Q9ZCJ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YBK5 Q9YBK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PJ11 Q9PJ11]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43712 P43712]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Z8P1 Q9Z8P1]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67041 O67041]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZMY1 Q9ZMY1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PKF6 Q9PKF6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P63458 P63458]
| + | |
− | ** [http://www.uniprot.org/uniprot/O84241 O84241]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WZQ5 Q9WZQ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P71019 P71019]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07149 P07149]
| + | |
− | ** [http://www.uniprot.org/uniprot/P73242 P73242]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8RU07 Q8RU07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q54205 Q54205]
| + | |
− | ** [http://www.uniprot.org/uniprot/O54437 O54437]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q56692 Q56692]
| + | |
− | ** [http://www.uniprot.org/uniprot/O13698 O13698]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RA34 Q9RA34]
| + | |
− | ** [http://www.uniprot.org/uniprot/O69476 O69476]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12276 P12276]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12785 P12785]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=polyketide_synthase}}
| + | |
− | {{#set: common name=malonyl-_:acp_transacylase}}
| + | |
− | {{#set: ec number=EC-2.3.1.86}}
| + | |
− | {{#set: ec number=EC-2.3.1.85}}
| + | |
− | {{#set: ec number=EC-2.3.1.39}}
| + | |
− | {{#set: gene associated=Tiso_gene_135|Tiso_gene_500|Tiso_gene_10876|Tiso_gene_13394|Tiso_gene_19309|Tiso_gene_136|Tiso_gene_18460}}
| + | |
− | {{#set: in pathway=PWY-6799|PWY-7388|PWY-4381}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=synechocystis|esiliculosus}} | + | |
− | {{#set: reconstruction category=manual}} | + | |
− | {{#set: reconstruction source=primary_network}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
| + | |