Difference between revisions of "CPD-14277"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14277 CPD-14277] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)CO...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14277 CPD-14277] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (3R)-3-hydroxy-lignoceroyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=QIBKBVRVOFIKLN-YSOWJFSKSA-J | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1130.129 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13304]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13300]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193809 72193809] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76377 76377] |
| − | + | {{#set: smiles=CCCCCCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}} | |
| − | + | {{#set: common name=(3R)-3-hydroxy-lignoceroyl-CoA}} | |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=QIBKBVRVOFIKLN-YSOWJFSKSA-J}} |
| − | {{#set: | + | {{#set: molecular weight=1130.129 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-13304}} |
| − | {{#set: molecular weight= | + | {{#set: produced by=RXN-13300}} |
| − | {{#set: consumed by= | + | |
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite CPD-14277
- smiles:
- CCCCCCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
- common name:
- (3R)-3-hydroxy-lignoceroyl-CoA
- inchi key:
- InChIKey=QIBKBVRVOFIKLN-YSOWJFSKSA-J
- molecular weight:
- 1130.129
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.
