|
|
| (3 intermediate revisions by the same user not shown) |
| Line 1: |
Line 1: |
| − | [[Category:Reaction]] | + | [[Category:Metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHENYLTHFCYCLOHYDRO-RXN METHENYLTHFCYCLOHYDRO-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == |
| − | * direction: | + | * smiles: |
| − | ** REVERSIBLE | + | ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) |
| − | * ec number: | + | * common name: |
| − | ** [http://enzyme.expasy.org/EC/3.5.4.9 EC-3.5.4.9] | + | ** β-L-galactose 1-phosphate |
| | + | * inchi key: |
| | + | ** InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L |
| | + | * molecular weight: |
| | + | ** 258.121 |
| | * Synonym(s): | | * Synonym(s): |
| | | | |
| − | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
| − | * With identifiers:
| + | * [[RXNQT-4142]] |
| − | ** 1 [[WATER]][c] '''+''' 1 [[5-10-METHENYL-THF-GLU-N]][c] '''<=>''' 1 [[FORMYL-THF-GLU-N]][c] '''+''' 1 [[PROTON]][c]
| + | == Reaction(s) known to produce the compound == |
| − | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
| − | ** 1 H2O[c] '''+''' 1 a 5,10-methenyltetrahydrofolate[c] '''<=>''' 1 an N10-formyl-tetrahydrofolate[c] '''+''' 1 H+[c]
| + | |
| − | | + | |
| − | == Genes associated with this reaction ==
| + | |
| − | == Pathways ==
| + | |
| − | * [[PWY-1722]], formate assimilation into 5,10-methylenetetrahydrofolate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1722 PWY-1722]
| + | |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
| − | * [[PWY-3841]], folate transformations II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841]
| + | |
| − | ** '''9''' reactions found over '''11''' reactions in the full pathway
| + | |
| − | * [[1CMET2-PWY]], N10-formyl-tetrahydrofolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=1CMET2-PWY 1CMET2-PWY]
| + | |
| − | ** '''7''' reactions found over '''9''' reactions in the full pathway
| + | |
| − | * [[PWY-5030]], L-histidine degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5030 PWY-5030] | + | |
| − | ** '''1''' reactions found over '''6''' reactions in the full pathway
| + | |
| − | * [[P164-PWY]], purine nucleobases degradation I (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=P164-PWY P164-PWY]
| + | |
| − | ** '''4''' reactions found over '''17''' reactions in the full pathway
| + | |
| − | * [[CODH-PWY]], reductive acetyl coenzyme A pathway I (homoacetogenic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=CODH-PWY CODH-PWY]
| + | |
| − | ** '''5''' reactions found over '''9''' reactions in the full pathway
| + | |
| − | * [[PWY-5497]], purine nucleobases degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497]
| + | |
| − | ** '''7''' reactions found over '''24''' reactions in the full pathway
| + | |
| − | * [[PWY-2201]], folate transformations I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2201 PWY-2201]
| + | |
| − | ** '''7''' reactions found over '''12''' reactions in the full pathway
| + | |
| − | * [[PWY-6613]], tetrahydrofolate salvage from 5,10-methenyltetrahydrofolate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6613 PWY-6613]
| + | |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
| − | == Reconstruction information == | + | |
| − | * [[manual]]:
| + | |
| − | ** [[primary_network]]
| + | |
| | == External links == | | == External links == |
| − | * RHEA: | + | * PUBCHEM: |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23700 23700] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728461 71728461] |
| − | * LIGAND-RXN: | + | * CHEBI: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01655 R01655] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75522 75522] |
| − | * UNIPROT:
| + | * LIGAND-CPD: |
| − | ** [http://www.uniprot.org/uniprot/P09440 P09440]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15926 C15926] |
| − | ** [http://www.uniprot.org/uniprot/P07245 P07245]
| + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)}} |
| − | ** [http://www.uniprot.org/uniprot/P11586 P11586] | + | {{#set: common name=β-L-galactose 1-phosphate}} |
| − | ** [http://www.uniprot.org/uniprot/P18155 P18155] | + | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L}} |
| − | ** [http://www.uniprot.org/uniprot/P44313 P44313]
| + | {{#set: molecular weight=258.121 }} |
| − | ** [http://www.uniprot.org/uniprot/P47259 P47259]
| + | {{#set: consumed by=RXNQT-4142}} |
| − | ** [http://www.uniprot.org/uniprot/P13995 P13995]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P54382 P54382]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O67736 O67736]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9JWI9 Q9JWI9]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9PP68 Q9PP68]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P24186 P24186]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q04448 Q04448]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q60006 Q60006]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q27772 Q27772]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P51696 P51696]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O68031 O68031]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9ZTV0 Q9ZTV0]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9X7F6 Q9X7F6]
| + | |
| − | {{#set: direction=REVERSIBLE}}
| + | |
| − | {{#set: ec number=EC-3.5.4.9}} | + | |
| − | {{#set: in pathway=PWY-1722|PWY-3841|1CMET2-PWY|PWY-5030|P164-PWY|CODH-PWY|PWY-5497|PWY-2201|PWY-6613}} | + | |
| − | {{#set: reconstruction category=manual}} | + | |
| − | {{#set: reconstruction source=primary_network}} | + | |
