Difference between revisions of "Tiso gene 178"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_178 == * right end position: ** 26768 * transcription direction: ** POSITIVE * left end position: ** 24658 * centisome position: ** 41.3052...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] ==
+
== Gene Tiso_gene_178 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 26768
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MMZJVINJFSRJOK-CYNJBPNESA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
+
** 24658
−
* molecular weight:
+
* centisome position:
−
** 1102.034    
+
** 41.30526    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16131]]
+
* Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-16130]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=26768}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551529 72551529]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=24658}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76464 76464]
+
{{#set: centisome position=41.30526   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
−
{{#set: inchi key=InChIKey=MMZJVINJFSRJOK-CYNJBPNESA-J}}
+
−
{{#set: common name=(2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA}}
+
−
{{#set: molecular weight=1102.034   }}
+
−
{{#set: consumed by=RXN-16131}}
+
−
{{#set: produced by=RXN-16130}}
+

Latest revision as of 20:18, 21 March 2018

Gene Tiso_gene_178

  • right end position:
    • 26768
  • transcription direction:
    • POSITIVE
  • left end position:
    • 24658
  • centisome position:
    • 41.30526
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_178&oldid=47646"