Difference between revisions of "CPD-7100"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10897 == * left end position: ** 250 * transcription direction: ** POSITIVE * right end position: ** 3561 * centisome position: ** 3.043584...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * common name: ** (2S)-2-iso...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_10897 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] ==
* left end position:
+
* smiles:
** 250
+
** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C
* transcription direction:
+
* common name:
** POSITIVE
+
** (2S)-2-isopropyl-3-oxosuccinate
* right end position:
+
* inchi key:
** 3561
+
** InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L
* centisome position:
+
* molecular weight:
** 3.043584    
+
** 172.137    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-isopropyl-3-oxosuccinate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.2.1.37-RXN]]
+
* [[RXN-7800]]
** experimental_annotation
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
* [[IMDH]]
* [[3.2.1.55-RXN]]
+
== Reaction(s) of unknown directionality ==
** experimental_annotation
+
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
***automated-name-match
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=250}}
+
* LIGAND-CPD:
{{#set: transcription direction=POSITIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04236 C04236]
{{#set: right end position=3561}}
+
* HMDB : HMDB12149
{{#set: centisome position=3.043584   }}
+
* CHEBI:
{{#set: reaction associated=3.2.1.37-RXN|3.2.1.55-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17214 17214]
 +
* BIGG : 3c4mop
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419705 6419705]
 +
{{#set: smiles=CC(C(C(=O)[O-])C(=O)C(=O)[O-])C}}
 +
{{#set: common name=(2S)-2-isopropyl-3-oxosuccinate}}
 +
{{#set: inchi key=InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L}}
 +
{{#set: molecular weight=172.137   }}
 +
{{#set: common name=2-isopropyl-3-oxosuccinate}}
 +
{{#set: consumed by=RXN-7800}}
 +
{{#set: produced by=IMDH}}
 +
{{#set: reversible reaction associated=3-ISOPROPYLMALDEHYDROG-RXN}}

Latest revision as of 20:18, 21 March 2018

Metabolite CPD-7100

  • smiles:
    • CC(C(C(=O)[O-])C(=O)C(=O)[O-])C
  • common name:
    • (2S)-2-isopropyl-3-oxosuccinate
  • inchi key:
    • InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L
  • molecular weight:
    • 172.137
  • Synonym(s):
    • 2-isopropyl-3-oxosuccinate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C(C(=O)[O-])C(=O)C(=O)[O-])C" cannot be used as a page name in this wiki.