Difference between revisions of "BENZALDEHYDE-DEHYDROGENASE-NADP+-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == * smiles: ** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BENZALDEHYDE-DEHYDROGENASE-NADP+-RXN BENZALDEHYDE-DEHYDROGENASE-NADP+-RXN] == * direction: ** LEFT-...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BENZALDEHYDE-DEHYDROGENASE-NADP+-RXN BENZALDEHYDE-DEHYDROGENASE-NADP+-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.2.1.7 EC-1.2.1.7] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | == | + | ** 1 [[BENZALDEHYDE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NADP]][c] '''=>''' 1 [[NADPH]][c] '''+''' 1 [[BENZOATE]][c] '''+''' 2 [[PROTON]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 1 benzaldehyde[c] '''+''' 1 H2O[c] '''+''' 1 NADP+[c] '''=>''' 1 NADPH[c] '''+''' 1 benzoate[c] '''+''' 2 H+[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY-1501]], mandelate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1501 PWY-1501] | ||
| + | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * LIGAND- | + | * LIGAND-RXN: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01420 R01420] |
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: ec number=EC-1.2.1.7}} |
| − | {{#set: | + | {{#set: in pathway=PWY-1501}} |
| + | {{#set: reconstruction category=annotation}} | ||
| + | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
| + | {{#set: reconstruction tool=pathwaytools}} | ||
Latest revision as of 20:18, 21 March 2018
Contents
Reaction BENZALDEHYDE-DEHYDROGENASE-NADP+-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 benzaldehyde[c] + 1 H2O[c] + 1 NADP+[c] => 1 NADPH[c] + 1 benzoate[c] + 2 H+[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN:
