Difference between revisions of "RXN-9597"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G3P G3P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(=O)[O-] * inchi key: ** InChIKey=OSJPPGNTCRNQ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9597 RXN-9597] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9597 RXN-9597] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.4.3.21 EC-1.4.3.21] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | + | * With identifiers: | |
| − | * [[ | + | ** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Primary-Amines]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[Aldehydes]][c] |
| − | + | * With common name(s): | |
| − | + | ** 1 oxygen[c] '''+''' 1 H2O[c] '''+''' 1 a primary amine[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 ammonium[c] '''+''' 1 an aldehyde[c] | |
| − | + | ||
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Tiso_gene_8756]] |
| − | * [[ | + | ** Source: [[orthology-esiliculosus]] |
| − | * [[ | + | == Pathways == |
| − | * [[ | + | == Reconstruction information == |
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01853 R01853] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.4.3.21}} | |
| − | + | {{#set: gene associated=Tiso_gene_8756}} | |
| − | * LIGAND- | + | {{#set: in pathway=}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=orthology}} |
| − | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:18, 21 March 2018
Contents
Reaction RXN-9597
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OXYGEN-MOLECULE[c] + 1 WATER[c] + 1 Primary-Amines[c] => 1 HYDROGEN-PEROXIDE[c] + 1 AMMONIUM[c] + 1 Aldehydes[c]
- With common name(s):
- 1 oxygen[c] + 1 H2O[c] + 1 a primary amine[c] => 1 hydrogen peroxide[c] + 1 ammonium[c] + 1 an aldehyde[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_8756
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- LIGAND-RXN:
