Difference between revisions of "Tiso gene 4992"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9923 CPD-9923] == * smiles: ** C1(=CC(O)C(C(=O)[O-])C(=C1)C(=O)CCC(=O)[O-]) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_4992 == * Synonym(s): == Reactions associated == * Reaction: CYTOCHROME-C-PEROXIDASE-RXN ** Source: [[annotation-in-silico_annotation]...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4992 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[CYTOCHROME-C-PEROXIDASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=CYTOCHROME-C-PEROXIDASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:18, 21 March 2018
Gene Tiso_gene_4992
- Synonym(s):
Reactions associated
- Reaction: CYTOCHROME-C-PEROXIDASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation