Difference between revisions of "RXN-5285"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] == * smiles: ** CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5285 RXN-5285] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF ** protochlorophyllide_re...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5285 RXN-5285] ==
* smiles:
+
* direction:
** CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=CHMQNMKVOYFHHX-SGPQCWJRSA-J
+
 
* common name:
 
* common name:
** 3R-hydroxy-lesqueroloyl-CoA
+
** ORF
* molecular weight:
+
** protochlorophyllide_reductase
** 1088.005   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.33 EC-1.3.1.33]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-14493]]
+
** 1 [[PROTON]][c] '''+''' 1 [[DIVINYL-PROTOCHLOROPHYLLIDE-A]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[DIVINYLCHLOROPHYLLIDE-A]][c] '''+''' 1 [[NADP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 3,8-divinyl protochlorophyllide a[c] '''+''' 1 NADPH[c] '''=>''' 1 3,8-divinyl chlorophyllide a[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17141]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_19518]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Tiso_gene_10077]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[CHLOROPHYLL-SYN]], 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819813 91819813]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06286 R06286]
{{#set: smiles=CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=CHMQNMKVOYFHHX-SGPQCWJRSA-J}}
+
{{#set: common name=ORF}}
{{#set: common name=3R-hydroxy-lesqueroloyl-CoA}}
+
{{#set: common name=protochlorophyllide_reductase}}
{{#set: molecular weight=1088.005    }}
+
{{#set: ec number=EC-1.3.1.33}}
{{#set: produced by=RXN-14493}}
+
{{#set: gene associated=Tiso_gene_17141|Tiso_gene_19518|Tiso_gene_10077}}
 +
{{#set: in pathway=CHLOROPHYLL-SYN}}
 +
{{#set: reconstruction category=orthology|manual|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|manual-primary_network|annotation-experimental_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:12, 21 March 2018

Reaction RXN-5285

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
    • protochlorophyllide_reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • CHLOROPHYLL-SYN, 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): CHLOROPHYLL-SYN
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links