Difference between revisions of "CPD-11520"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15878 RXN-15878] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15878 RXN-15878] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/1.17.7.3 EC-1.17.7.3]
+
** OPC8-3-ketoacyl-CoA
 +
* inchi key:
 +
** InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J
 +
* molecular weight:
 +
** 1053.904   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-10699]]
** 1 [[Reduced-flavodoxins]][c] '''+''' 1 [[2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[Oxidized-flavodoxins]][c] '''+''' 1 [[HYDROXY-METHYL-BUTENYL-DIP]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-10698]]
** 1 a reduced flavodoxin[c] '''+''' 1 2-C-methyl-D-erythritol-2,4-cyclodiphosphate[c] '''=>''' 1 H2O[c] '''+''' 1 an oxidized flavodoxin[c] '''+''' 1 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[c] '''+''' 1 H+[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[NONMEVIPP-PWY]], methylerythritol phosphate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY]
+
** '''9''' reactions found over '''9''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[manual]]:
+
** [[primary_network]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-1.17.7.3}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237200 44237200]
{{#set: in pathway=NONMEVIPP-PWY}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
{{#set: reconstruction category=manual}}
+
{{#set: common name=OPC8-3-ketoacyl-CoA}}
{{#set: reconstruction source=primary_network}}
+
{{#set: inchi key=InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J}}
 +
{{#set: molecular weight=1053.904    }}
 +
{{#set: consumed by=RXN-10699}}
 +
{{#set: produced by=RXN-10698}}

Latest revision as of 21:19, 21 March 2018

Metabolite CPD-11520

  • smiles:
    • CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
  • common name:
    • OPC8-3-ketoacyl-CoA
  • inchi key:
    • InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J
  • molecular weight:
    • 1053.904
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.